C23H31N3O4 — CID 67096236
(E)-but-2-enedioic acid;2-(3,3,4,5,5-pentamethyl-1,4-diazepan-1-yl)quinoline (PubChem CID 67096236) has the molecular formula C23H31N3O4 and a molecular weight of 413.52 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-(3,3,4,5,5-pentamethyl-1,4-diazepan-1-yl)quinoline.
| Compound Name | (E)-but-2-enedioic acid;2-(3,3,4,5,5-pentamethyl-1,4-diazepan-1-yl)quinoline |
|---|---|
| PubChem CID | 67096236 |
| Molecular Formula | C23H31N3O4 |
| Molecular Weight | 413.52 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | (E)-but-2-enedioic acid;2-(3,3,4,5,5-pentamethyl-1,4-diazepan-1-yl)quinoline |
| SMILES | CN1C(C)(C)CCN(c2ccc3ccccc3n2)CC1(C)C.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C19H27N3.C4H4O4/c1-18(2)12-13-22(14-19(3,4)21(18)5)17-11-10-15-8-6-7-9-16(15)20-17;5-3(6)1-2-4(7)8/h6-11H,12-14H2,1-5H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | SLLJVIKNDSAMMJ-WLHGVMLRSA-N |
| XLogP | 3.65 |
| TPSA | 93.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.52 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|