C15H14BN3O3+2 — CID 158143818
(4-phenyl-4-aza-6,12-diazoniatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-12-yl)oxyboronic acid (PubChem CID 158143818) has the molecular formula C15H14BN3O3+2 and a molecular weight of 295.11 g/mol. Its IUPAC name is (4-phenyl-4-aza-6,12-diazoniatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-12-yl)oxyboronic acid.
| Compound Name | (4-phenyl-4-aza-6,12-diazoniatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-12-yl)oxyboronic acid |
|---|---|
| PubChem CID | 158143818 |
| Molecular Formula | C15H14BN3O3+2 |
| Molecular Weight | 295.11 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (4-phenyl-4-aza-6,12-diazoniatricyclo[6.4.0.02,6]dodeca-1(8),2,5,9,11-pentaen-12-yl)oxyboronic acid |
| SMILES | OB(O)O[n+]1cccc2c1-c1cn(-c3ccccc3)c[n+]1C2 |
| InChI | InChI=1S/C15H14BN3O3/c20-16(21)22-19-8-4-5-12-9-18-11-17(10-14(18)15(12)19)13-6-2-1-3-7-13/h1-8,10-11,20-21H,9H2/q+2 |
| InChIKey | OGJPFOWFFQMWJI-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 62.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.11 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|