C22H38 — CID 158147204
1,2,3,4,7-penta(propan-2-yl)cyclohepta-1,3,5-triene (PubChem CID 158147204) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is 1,2,3,4,7-penta(propan-2-yl)cyclohepta-1,3,5-triene.
| Compound Name | 1,2,3,4,7-penta(propan-2-yl)cyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 158147204 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | 1,2,3,4,7-penta(propan-2-yl)cyclohepta-1,3,5-triene |
| SMILES | CC(C)C1=C(C(C)C)C(C(C)C)=C(C(C)C)C(C(C)C)C=C1 |
| InChI | InChI=1S/C22H38/c1-13(2)18-11-12-19(14(3)4)21(16(7)8)22(17(9)10)20(18)15(5)6/h11-18H,1-10H3 |
| InChIKey | MKVBQDBGHBCFOP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |