C22H24N2O3 — CID 158147510
2-(4-methoxyphenyl)acetonitrile;4-(4-methoxyphenyl)oxane-4-carbonitrile (PubChem CID 158147510) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is 2-(4-methoxyphenyl)acetonitrile;4-(4-methoxyphenyl)oxane-4-carbonitrile.
| Compound Name | 2-(4-methoxyphenyl)acetonitrile;4-(4-methoxyphenyl)oxane-4-carbonitrile |
|---|---|
| PubChem CID | 158147510 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | 2-(4-methoxyphenyl)acetonitrile;4-(4-methoxyphenyl)oxane-4-carbonitrile |
| SMILES | COc1ccc(C2(C#N)CCOCC2)cc1.COc1ccc(CC#N)cc1 |
| InChI | InChI=1S/C13H15NO2.C9H9NO/c1-15-12-4-2-11(3-5-12)13(10-14)6-8-16-9-7-13;1-11-9-4-2-8(3-5-9)6-7-10/h2-5H,6-9H2,1H3;2-5H,6H2,1H3 |
| InChIKey | FURSMGLPTZNKBT-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 75.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |