C21H30N2O2 — CID 59837541
4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxane-4-carbonitrile (PubChem CID 59837541) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxane-4-carbonitrile.
| Compound Name | 4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxane-4-carbonitrile |
|---|---|
| PubChem CID | 59837541 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 4-[4-[3-[(2R,5R)-2,5-dimethylpyrrolidin-1-yl]propoxy]phenyl]oxane-4-carbonitrile |
| SMILES | C[C@@H]1CC[C@@H](C)N1CCCOc1ccc(C2(C#N)CCOCC2)cc1 |
| InChI | InChI=1S/C21H30N2O2/c1-17-4-5-18(2)23(17)12-3-13-25-20-8-6-19(7-9-20)21(16-22)10-14-24-15-11-21/h6-9,17-18H,3-5,10-15H2,1-2H3/t17-,18-/m1/s1 |
| InChIKey | WNJPEDPHRPKFEW-QZTJIDSGSA-N |
| XLogP | 3.90 |
| TPSA | 45.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|