C26H25Cl2N3O2 — CID 158151638
(3S)-8-chloro-3-[(2-chlorophenyl)methyl]-1-[6-(3-methoxypropylamino)-3-pyridinyl]-3,5-dihydro-2-benzazepin-4-one (PubChem CID 158151638) has the molecular formula C26H25Cl2N3O2 and a molecular weight of 482.41 g/mol. Its IUPAC name is (3S)-8-chloro-3-[(2-chlorophenyl)methyl]-1-[6-(3-methoxypropylamino)-3-pyridinyl]-3,5-dihydro-2-benzazepin-4-one.
| Compound Name | (3S)-8-chloro-3-[(2-chlorophenyl)methyl]-1-[6-(3-methoxypropylamino)-3-pyridinyl]-3,5-dihydro-2-benzazepin-4-one |
|---|---|
| PubChem CID | 158151638 |
| Molecular Formula | C26H25Cl2N3O2 |
| Molecular Weight | 482.41 g/mol |
| Exact Mass | 481.13 |
| IUPAC Name | (3S)-8-chloro-3-[(2-chlorophenyl)methyl]-1-[6-(3-methoxypropylamino)-3-pyridinyl]-3,5-dihydro-2-benzazepin-4-one |
| SMILES | COCCCNc1ccc(C2=N[C@@H](Cc3ccccc3Cl)C(=O)Cc3ccc(Cl)cc32)cn1 |
| InChI | InChI=1S/C26H25Cl2N3O2/c1-33-12-4-11-29-25-10-8-19(16-30-25)26-21-15-20(27)9-7-17(21)14-24(32)23(31-26)13-18-5-2-3-6-22(18)28/h2-3,5-10,15-16,23H,4,11-14H2,1H3,(H,29,30)/t23-/m0/s1 |
| InChIKey | MHAPHZJTEXGFPV-QHCPKHFHSA-N |
| XLogP | 5.41 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.41 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|