C25H24F3N4O2- — CID 158159719
4-(3,4-dimethylphenyl)pyrimidine-5-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide (PubChem CID 158159719) has the molecular formula C25H24F3N4O2- and a molecular weight of 469.49 g/mol. Its IUPAC name is 4-(3,4-dimethylphenyl)pyrimidine-5-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide.
| Compound Name | 4-(3,4-dimethylphenyl)pyrimidine-5-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide |
|---|---|
| PubChem CID | 158159719 |
| Molecular Formula | C25H24F3N4O2- |
| Molecular Weight | 469.49 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | 4-(3,4-dimethylphenyl)pyrimidine-5-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide |
| SMILES | Cc1ccc(-c2ncncc2C(=O)O)cc1C.FC(F)(F)C[N-]CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C13H12N2O2.C12H12F3N2/c1-8-3-4-10(5-9(8)2)12-11(13(16)17)6-14-7-15-12;13-12(14,15)8-16-6-5-9-7-17-11-4-2-1-3-10(9)11/h3-7H,1-2H3,(H,16,17);1-4,7,17H,5-6,8H2/q;-1 |
| InChIKey | FWCUVKWIJLNUBX-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 92.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.49 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|