C23H19F4N4O2- — CID 157150667
3-(4-fluorophenyl)pyrazine-2-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide (PubChem CID 157150667) has the molecular formula C23H19F4N4O2- and a molecular weight of 459.42 g/mol. Its IUPAC name is 3-(4-fluorophenyl)pyrazine-2-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide.
| Compound Name | 3-(4-fluorophenyl)pyrazine-2-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide |
|---|---|
| PubChem CID | 157150667 |
| Molecular Formula | C23H19F4N4O2- |
| Molecular Weight | 459.42 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 3-(4-fluorophenyl)pyrazine-2-carboxylic acid;2-(1H-indol-3-yl)ethyl-(2,2,2-trifluoroethyl)azanide |
| SMILES | FC(F)(F)C[N-]CCc1c[nH]c2ccccc12.O=C(O)c1nccnc1-c1ccc(F)cc1 |
| InChI | InChI=1S/C12H12F3N2.C11H7FN2O2/c13-12(14,15)8-16-6-5-9-7-17-11-4-2-1-3-10(9)11;12-8-3-1-7(2-4-8)9-10(11(15)16)14-6-5-13-9/h1-4,7,17H,5-6,8H2;1-6H,(H,15,16)/q-1; |
| InChIKey | ALFJAXLPTWTGJG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 92.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.42 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|