C4H11N6O4P — CID 158164410
methyl hydrogen phosphate;1,3,5-triazin-1-ium-2,4,6-triamine (PubChem CID 158164410) has the molecular formula C4H11N6O4P and a molecular weight of 238.14 g/mol. Its IUPAC name is methyl hydrogen phosphate;1,3,5-triazin-1-ium-2,4,6-triamine.
| Compound Name | methyl hydrogen phosphate;1,3,5-triazin-1-ium-2,4,6-triamine |
|---|---|
| PubChem CID | 158164410 |
| Molecular Formula | C4H11N6O4P |
| Molecular Weight | 238.14 g/mol |
| Exact Mass | 238.06 |
| IUPAC Name | methyl hydrogen phosphate;1,3,5-triazin-1-ium-2,4,6-triamine |
| SMILES | COP(=O)([O-])O.Nc1nc(N)[nH+]c(N)n1 |
| InChI | InChI=1S/C3H6N6.CH5O4P/c4-1-7-2(5)9-3(6)8-1;1-5-6(2,3)4/h(H6,4,5,6,7,8,9);1H3,(H2,2,3,4) |
| InChIKey | FWQZGRMYDOEPBG-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 187.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.14 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|