C3H7N6O7P2-3 — CID 162367976
[hydroxy(oxido)phosphoryl] phosphate;1,3,5-triazine-2,4,6-triamine (PubChem CID 162367976) has the molecular formula C3H7N6O7P2-3 and a molecular weight of 301.07 g/mol. Its IUPAC name is [hydroxy(oxido)phosphoryl] phosphate;1,3,5-triazine-2,4,6-triamine.
| Compound Name | [hydroxy(oxido)phosphoryl] phosphate;1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 162367976 |
| Molecular Formula | C3H7N6O7P2-3 |
| Molecular Weight | 301.07 g/mol |
| Exact Mass | 300.99 |
| IUPAC Name | [hydroxy(oxido)phosphoryl] phosphate;1,3,5-triazine-2,4,6-triamine |
| SMILES | Nc1nc(N)nc(N)n1.O=P([O-])([O-])OP(=O)([O-])O |
| InChI | InChI=1S/C3H6N6.H4O7P2/c4-1-7-2(5)9-3(6)8-1;1-8(2,3)7-9(4,5)6/h(H6,4,5,6,7,8,9);(H2,1,2,3)(H2,4,5,6)/p-3 |
| InChIKey | XZTOTRSSGPPNTB-UHFFFAOYSA-K |
| XLogP | -4.09 |
| TPSA | 249.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.07 |
| LogP ≤ 5 | -4.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|