About ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene
ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene (PubChem CID 158173229) has the molecular formula C31H34O
and a molecular weight of 422.61 g/mol. Its IUPAC name is ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene |
| PubChem CID | 158173229 |
| Molecular Formula | C31H34O |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.26 |
| IUPAC Name | ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene |
| SMILES | CC.CCc1ccc(Oc2ccc(CC)cc2)cc1.c1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C16H18O.C13H10.C2H6/c1-3-13-5-9-15(10-6-13)17-16-11-7-14(4-2)8-12-16;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h5-12H,3-4H2,1-2H3;1-8H,9H2;1-2H3 |
| InChIKey | FXRYWIHZACBZQT-UHFFFAOYSA-N |
| XLogP | 8.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene?
The IUPAC name of ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene (CID 158173229) is ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene.
What is the SMILES notation for ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene?
The canonical SMILES for ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene is CC.CCc1ccc(Oc2ccc(CC)cc2)cc1.c1ccc2c(c1)Cc1ccccc1-2.
What is the InChIKey of ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene?
The InChIKey is FXRYWIHZACBZQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18O.C13H10.C2H6/c1-3-13-5-9-15(10-6-13)17-16-11-7-14(4-2)8-12-16;1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12;1-2/h5-12H,3-4H2,1-2H3;1-8H,9H2;1-2H3.
What are the key properties of ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene?
ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene has a molecular weight of 422.61 g/mol, XLogP of 8.89, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-(4-ethylphenoxy)benzene;9H-fluorene is sourced from PubChem (CID 158173229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).