C34H32BClN2O2 — CID 158175707
1-chloro-4-methylisoquinoline;4-methyl-1-(3-methylphenyl)isoquinoline;(3-methylphenyl)boronic acid (PubChem CID 158175707) has the molecular formula C34H32BClN2O2 and a molecular weight of 546.91 g/mol. Its IUPAC name is 1-chloro-4-methylisoquinoline;4-methyl-1-(3-methylphenyl)isoquinoline;(3-methylphenyl)boronic acid.
| Compound Name | 1-chloro-4-methylisoquinoline;4-methyl-1-(3-methylphenyl)isoquinoline;(3-methylphenyl)boronic acid |
|---|---|
| PubChem CID | 158175707 |
| Molecular Formula | C34H32BClN2O2 |
| Molecular Weight | 546.91 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 1-chloro-4-methylisoquinoline;4-methyl-1-(3-methylphenyl)isoquinoline;(3-methylphenyl)boronic acid |
| SMILES | Cc1cccc(-c2ncc(C)c3ccccc23)c1.Cc1cccc(B(O)O)c1.Cc1cnc(Cl)c2ccccc12 |
| InChI | InChI=1S/C17H15N.C10H8ClN.C7H9BO2/c1-12-6-5-7-14(10-12)17-16-9-4-3-8-15(16)13(2)11-18-17;1-7-6-12-10(11)9-5-3-2-4-8(7)9;1-6-3-2-4-7(5-6)8(9)10/h3-11H,1-2H3;2-6H,1H3;2-5,9-10H,1H3 |
| InChIKey | FXYYLJRINFCMEJ-UHFFFAOYSA-N |
| XLogP | 7.39 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.91 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|