C12H24F3N3O2S — CID 158178974
cyclohexanamine;1,1,1-trifluoro-N-piperidin-3-ylmethanesulfonamide (PubChem CID 158178974) has the molecular formula C12H24F3N3O2S and a molecular weight of 331.40 g/mol. Its IUPAC name is cyclohexanamine;1,1,1-trifluoro-N-piperidin-3-ylmethanesulfonamide.
| Compound Name | cyclohexanamine;1,1,1-trifluoro-N-piperidin-3-ylmethanesulfonamide |
|---|---|
| PubChem CID | 158178974 |
| Molecular Formula | C12H24F3N3O2S |
| Molecular Weight | 331.40 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | cyclohexanamine;1,1,1-trifluoro-N-piperidin-3-ylmethanesulfonamide |
| SMILES | NC1CCCCC1.O=S(=O)(NC1CCCNC1)C(F)(F)F |
| InChI | InChI=1S/C6H11F3N2O2S.C6H13N/c7-6(8,9)14(12,13)11-5-2-1-3-10-4-5;7-6-4-2-1-3-5-6/h5,10-11H,1-4H2;6H,1-5,7H2 |
| InChIKey | FYIQHYPZEVIULP-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.40 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |