C29H37N3O4 — CID 158181552
6-amino-1-(3-methylphenyl)hexan-1-one;ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate (PubChem CID 158181552) has the molecular formula C29H37N3O4 and a molecular weight of 491.63 g/mol. Its IUPAC name is 6-amino-1-(3-methylphenyl)hexan-1-one;ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate.
| Compound Name | 6-amino-1-(3-methylphenyl)hexan-1-one;ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate |
|---|---|
| PubChem CID | 158181552 |
| Molecular Formula | C29H37N3O4 |
| Molecular Weight | 491.63 g/mol |
| Exact Mass | 491.28 |
| IUPAC Name | 6-amino-1-(3-methylphenyl)hexan-1-one;ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1cccc(Cn2nc(C)ccc2=O)c1.Cc1cccc(C(=O)CCCCCN)c1 |
| InChI | InChI=1S/C16H18N2O3.C13H19NO/c1-3-21-16(20)10-13-5-4-6-14(9-13)11-18-15(19)8-7-12(2)17-18;1-11-6-5-7-12(10-11)13(15)8-3-2-4-9-14/h4-9H,3,10-11H2,1-2H3;5-7,10H,2-4,8-9,14H2,1H3 |
| InChIKey | FYQRZLDMUKUALQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.63 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|