C29H36N2O5 — CID 160924036
ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate;5-methoxy-1-(3-methylphenyl)pentan-2-one (PubChem CID 160924036) has the molecular formula C29H36N2O5 and a molecular weight of 492.62 g/mol. Its IUPAC name is ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate;5-methoxy-1-(3-methylphenyl)pentan-2-one.
| Compound Name | ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate;5-methoxy-1-(3-methylphenyl)pentan-2-one |
|---|---|
| PubChem CID | 160924036 |
| Molecular Formula | C29H36N2O5 |
| Molecular Weight | 492.62 g/mol |
| Exact Mass | 492.26 |
| IUPAC Name | ethyl 2-[3-[(3-methyl-6-oxopyridazin-1-yl)methyl]phenyl]acetate;5-methoxy-1-(3-methylphenyl)pentan-2-one |
| SMILES | CCOC(=O)Cc1cccc(Cn2nc(C)ccc2=O)c1.COCCCC(=O)Cc1cccc(C)c1 |
| InChI | InChI=1S/C16H18N2O3.C13H18O2/c1-3-21-16(20)10-13-5-4-6-14(9-13)11-18-15(19)8-7-12(2)17-18;1-11-5-3-6-12(9-11)10-13(14)7-4-8-15-2/h4-9H,3,10-11H2,1-2H3;3,5-6,9H,4,7-8,10H2,1-2H3 |
| InChIKey | SSKIXAVGAWAHFG-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 87.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.62 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|