C17H26O3 — CID 15818383
ethyl (Z)-2-methyl-5-[(2R)-2-methyl-3-oxo-2-bicyclo[2.2.2]octanyl]pent-2-enoate (PubChem CID 15818383) has the molecular formula C17H26O3 and a molecular weight of 278.39 g/mol. Its IUPAC name is ethyl (Z)-2-methyl-5-[(2R)-2-methyl-3-oxo-2-bicyclo[2.2.2]octanyl]pent-2-enoate.
| Compound Name | ethyl (Z)-2-methyl-5-[(2R)-2-methyl-3-oxo-2-bicyclo[2.2.2]octanyl]pent-2-enoate |
|---|---|
| PubChem CID | 15818383 |
| Molecular Formula | C17H26O3 |
| Molecular Weight | 278.39 g/mol |
| Exact Mass | 278.19 |
| IUPAC Name | ethyl (Z)-2-methyl-5-[(2R)-2-methyl-3-oxo-2-bicyclo[2.2.2]octanyl]pent-2-enoate |
| SMILES | CCOC(=O)/C(C)=C\CC[C@@]1(C)C(=O)C2CCC1CC2 |
| InChI | InChI=1S/C17H26O3/c1-4-20-16(19)12(2)6-5-11-17(3)14-9-7-13(8-10-14)15(17)18/h6,13-14H,4-5,7-11H2,1-3H3/b12-6-/t13?,14?,17-/m1/s1 |
| InChIKey | SAUZHQWEIFRNHU-VBHDUYEDSA-N |
| XLogP | 3.67 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.39 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|