C19H29NO3 — CID 158186024
1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,3,5-trimethyl-2-methylideneindole (PubChem CID 158186024) has the molecular formula C19H29NO3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,3,5-trimethyl-2-methylideneindole.
| Compound Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,3,5-trimethyl-2-methylideneindole |
|---|---|
| PubChem CID | 158186024 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | 1-[2-[2-(2-methoxyethoxy)ethoxy]ethyl]-3,3,5-trimethyl-2-methylideneindole |
| SMILES | C=C1N(CCOCCOCCOC)c2ccc(C)cc2C1(C)C |
| InChI | InChI=1S/C19H29NO3/c1-15-6-7-18-17(14-15)19(3,4)16(2)20(18)8-9-22-12-13-23-11-10-21-5/h6-7,14H,2,8-13H2,1,3-5H3 |
| InChIKey | GBHHMJUIVVXFPB-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|