C21H36O8P2 — CID 158187579
(3S)-1-dimethoxyphosphoryl-3-methylhept-5-yn-2-one;(3S)-1-dimethoxyphosphoryl-3-methyloct-5-yn-2-one (PubChem CID 158187579) has the molecular formula C21H36O8P2 and a molecular weight of 478.46 g/mol. Its IUPAC name is (3S)-1-dimethoxyphosphoryl-3-methylhept-5-yn-2-one;(3S)-1-dimethoxyphosphoryl-3-methyloct-5-yn-2-one.
| Compound Name | (3S)-1-dimethoxyphosphoryl-3-methylhept-5-yn-2-one;(3S)-1-dimethoxyphosphoryl-3-methyloct-5-yn-2-one |
|---|---|
| PubChem CID | 158187579 |
| Molecular Formula | C21H36O8P2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | (3S)-1-dimethoxyphosphoryl-3-methylhept-5-yn-2-one;(3S)-1-dimethoxyphosphoryl-3-methyloct-5-yn-2-one |
| SMILES | CC#CC[C@H](C)C(=O)CP(=O)(OC)OC.CCC#CC[C@H](C)C(=O)CP(=O)(OC)OC |
| InChI | InChI=1S/C11H19O4P.C10H17O4P/c1-5-6-7-8-10(2)11(12)9-16(13,14-3)15-4;1-5-6-7-9(2)10(11)8-15(12,13-3)14-4/h10H,5,8-9H2,1-4H3;9H,7-8H2,1-4H3/t10-;9-/m00/s1 |
| InChIKey | FZIIQKINRSVTEF-CORIKADDSA-N |
| XLogP | 4.57 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|