C9H15O5P — CID 88549503
2-[ethyl(methoxy)phosphoryl]oxy-2-methylpent-3-ynoic acid (PubChem CID 88549503) has the molecular formula C9H15O5P and a molecular weight of 234.19 g/mol. Its IUPAC name is 2-[ethyl(methoxy)phosphoryl]oxy-2-methylpent-3-ynoic acid.
| Compound Name | 2-[ethyl(methoxy)phosphoryl]oxy-2-methylpent-3-ynoic acid |
|---|---|
| PubChem CID | 88549503 |
| Molecular Formula | C9H15O5P |
| Molecular Weight | 234.19 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | 2-[ethyl(methoxy)phosphoryl]oxy-2-methylpent-3-ynoic acid |
| SMILES | CC#CC(C)(OP(=O)(CC)OC)C(=O)O |
| InChI | InChI=1S/C9H15O5P/c1-5-7-9(3,8(10)11)14-15(12,6-2)13-4/h6H2,1-4H3,(H,10,11) |
| InChIKey | WFVAZSCZABRFBE-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.19 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|