C12H24O10P2 — CID 88549328
dimethyl 2,3-bis[[ethyl(methoxy)phosphoryl]oxy]butanedioate (PubChem CID 88549328) has the molecular formula C12H24O10P2 and a molecular weight of 390.26 g/mol. Its IUPAC name is dimethyl 2,3-bis[[ethyl(methoxy)phosphoryl]oxy]butanedioate.
| Compound Name | dimethyl 2,3-bis[[ethyl(methoxy)phosphoryl]oxy]butanedioate |
|---|---|
| PubChem CID | 88549328 |
| Molecular Formula | C12H24O10P2 |
| Molecular Weight | 390.26 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | dimethyl 2,3-bis[[ethyl(methoxy)phosphoryl]oxy]butanedioate |
| SMILES | CCP(=O)(OC)OC(C(=O)OC)C(OP(=O)(CC)OC)C(=O)OC |
| InChI | InChI=1S/C12H24O10P2/c1-7-23(15,19-5)21-9(11(13)17-3)10(12(14)18-4)22-24(16,8-2)20-6/h9-10H,7-8H2,1-6H3 |
| InChIKey | SOZINHBNNKZZCR-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 123.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.26 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|