C6H15N2O4P — CID 54500040
(2S)-2-amino-N-(dimethoxyphosphorylmethyl)propanamide (PubChem CID 54500040) has the molecular formula C6H15N2O4P and a molecular weight of 210.17 g/mol. Its IUPAC name is (2S)-2-amino-N-(dimethoxyphosphorylmethyl)propanamide.
| Compound Name | (2S)-2-amino-N-(dimethoxyphosphorylmethyl)propanamide |
|---|---|
| PubChem CID | 54500040 |
| Molecular Formula | C6H15N2O4P |
| Molecular Weight | 210.17 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (2S)-2-amino-N-(dimethoxyphosphorylmethyl)propanamide |
| SMILES | COP(=O)(CNC(=O)[C@H](C)N)OC |
| InChI | InChI=1S/C6H15N2O4P/c1-5(7)6(9)8-4-13(10,11-2)12-3/h5H,4,7H2,1-3H3,(H,8,9)/t5-/m0/s1 |
| InChIKey | YBTTVLZKXAAODO-YFKPBYRVSA-N |
| XLogP | -0.11 |
| TPSA | 90.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.17 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|