[3-(3-ethynylphenoxy)phenyl]methanamine chloride

C15H13ClNO- — CID 158188538

IUPAC[3-(3-ethynylphenoxy)phenyl]methanamine chloride
SMILESC#Cc1cccc(Oc2cccc(CN)c2)c1.[Cl-]
InChIInChI=1S/C15H13NO.ClH/c1-2-12-5-3-7-14(9-12)17-15-8-4-6-13(10-15)11-16;/h1,3-10H,11,16H2;1H/p-1
InChIKeyXTBZHUVAWTWVHH-UHFFFAOYSA-M
MW258.73 g/mol
LogP-0.08
Rot. Bonds3

About [3-(3-ethynylphenoxy)phenyl]methanamine chloride

[3-(3-ethynylphenoxy)phenyl]methanamine chloride (PubChem CID 158188538) has the molecular formula C15H13ClNO- and a molecular weight of 258.73 g/mol. Its IUPAC name is [3-(3-ethynylphenoxy)phenyl]methanamine chloride.

Molecular Properties

Compound Name[3-(3-ethynylphenoxy)phenyl]methanamine chloride
PubChem CID158188538
Molecular FormulaC15H13ClNO-
Molecular Weight258.73 g/mol
Exact Mass258.07
IUPAC Name[3-(3-ethynylphenoxy)phenyl]methanamine chloride
SMILESC#Cc1cccc(Oc2cccc(CN)c2)c1.[Cl-]
InChIInChI=1S/C15H13NO.ClH/c1-2-12-5-3-7-14(9-12)17-15-8-4-6-13(10-15)11-16;/h1,3-10H,11,16H2;1H/p-1
InChIKeyXTBZHUVAWTWVHH-UHFFFAOYSA-M
XLogP-0.08
TPSA35.25 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500258.73
LogP ≤ 5-0.08
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'triple_bond', 'substructure': 'N/A'}

Analyze [3-(3-ethynylphenoxy)phenyl]methanamine chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [3-(3-ethynylphenoxy)phenyl]methanamine chloride?
The IUPAC name of [3-(3-ethynylphenoxy)phenyl]methanamine chloride (CID 158188538) is [3-(3-ethynylphenoxy)phenyl]methanamine chloride.
What is the SMILES notation for [3-(3-ethynylphenoxy)phenyl]methanamine chloride?
The canonical SMILES for [3-(3-ethynylphenoxy)phenyl]methanamine chloride is C#Cc1cccc(Oc2cccc(CN)c2)c1.[Cl-].
What is the InChIKey of [3-(3-ethynylphenoxy)phenyl]methanamine chloride?
The InChIKey is XTBZHUVAWTWVHH-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H13NO.ClH/c1-2-12-5-3-7-14(9-12)17-15-8-4-6-13(10-15)11-16;/h1,3-10H,11,16H2;1H/p-1.
What are the key properties of [3-(3-ethynylphenoxy)phenyl]methanamine chloride?
[3-(3-ethynylphenoxy)phenyl]methanamine chloride has a molecular weight of 258.73 g/mol, XLogP of -0.08, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3-ethynylphenoxy)phenyl]methanamine chloride is sourced from PubChem (CID 158188538), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).