About azanium (3-ethyl-2-phenylphenyl) sulfate
azanium (3-ethyl-2-phenylphenyl) sulfate (PubChem CID 158190148) has the molecular formula C14H17NO4S
and a molecular weight of 295.36 g/mol. Its IUPAC name is azanium (3-ethyl-2-phenylphenyl) sulfate.
Molecular Properties
| Compound Name | azanium (3-ethyl-2-phenylphenyl) sulfate |
| PubChem CID | 158190148 |
| Molecular Formula | C14H17NO4S |
| Molecular Weight | 295.36 g/mol |
| Exact Mass | 295.09 |
| IUPAC Name | azanium (3-ethyl-2-phenylphenyl) sulfate |
| SMILES | CCc1cccc(OS(=O)(=O)[O-])c1-c1ccccc1.[NH4+] |
| InChI | InChI=1S/C14H14O4S.H3N/c1-2-11-9-6-10-13(18-19(15,16)17)14(11)12-7-4-3-5-8-12;/h3-10H,2H2,1H3,(H,15,16,17);1H3 |
| InChIKey | FZQOJPOQVQOTIZ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 102.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.36 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze azanium (3-ethyl-2-phenylphenyl) sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanium (3-ethyl-2-phenylphenyl) sulfate?
The IUPAC name of azanium (3-ethyl-2-phenylphenyl) sulfate (CID 158190148) is azanium (3-ethyl-2-phenylphenyl) sulfate.
What is the SMILES notation for azanium (3-ethyl-2-phenylphenyl) sulfate?
The canonical SMILES for azanium (3-ethyl-2-phenylphenyl) sulfate is CCc1cccc(OS(=O)(=O)[O-])c1-c1ccccc1.[NH4+].
What is the InChIKey of azanium (3-ethyl-2-phenylphenyl) sulfate?
The InChIKey is FZQOJPOQVQOTIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14O4S.H3N/c1-2-11-9-6-10-13(18-19(15,16)17)14(11)12-7-4-3-5-8-12;/h3-10H,2H2,1H3,(H,15,16,17);1H3.
What are the key properties of azanium (3-ethyl-2-phenylphenyl) sulfate?
azanium (3-ethyl-2-phenylphenyl) sulfate has a molecular weight of 295.36 g/mol, XLogP of 3.13, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azanium (3-ethyl-2-phenylphenyl) sulfate is sourced from PubChem (CID 158190148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).