C14H15NO2 — CID 150995923
3-ethyl-N,N-dihydroxy-2-phenylaniline (PubChem CID 150995923) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is 3-ethyl-N,N-dihydroxy-2-phenylaniline.
| Compound Name | 3-ethyl-N,N-dihydroxy-2-phenylaniline |
|---|---|
| PubChem CID | 150995923 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | 3-ethyl-N,N-dihydroxy-2-phenylaniline |
| SMILES | CCc1cccc(N(O)O)c1-c1ccccc1 |
| InChI | InChI=1S/C14H15NO2/c1-2-11-9-6-10-13(15(16)17)14(11)12-7-4-3-5-8-12/h3-10,16-17H,2H2,1H3 |
| InChIKey | LTCAWDGGNTWFBY-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|