C44H61B2BrN2O8 — CID 158201001
methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate;4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 158201001) has the molecular formula C44H61B2BrN2O8 and a molecular weight of 847.51 g/mol. Its IUPAC name is methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate;4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate;4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 158201001 |
| Molecular Formula | C44H61B2BrN2O8 |
| Molecular Weight | 847.51 g/mol |
| Exact Mass | 846.38 |
| IUPAC Name | methyl 2-bromo-3-cyclohexyl-1H-indole-6-carboxylate;methyl 3-cyclohexyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole-6-carboxylate;4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | CC1(C)OBOC1(C)C.COC(=O)c1ccc2c(C3CCCCC3)c(B3OC(C)(C)C(C)(C)O3)[nH]c2c1.COC(=O)c1ccc2c(C3CCCCC3)c(Br)[nH]c2c1 |
| InChI | InChI=1S/C22H30BNO4.C16H18BrNO2.C6H13BO2/c1-21(2)22(3,4)28-23(27-21)19-18(14-9-7-6-8-10-14)16-12-11-15(20(25)26-5)13-17(16)24-19;1-20-16(19)11-7-8-12-13(9-11)18-15(17)14(12)10-5-3-2-4-6-10;1-5(2)6(3,4)9-7-8-5/h11-14,24H,6-10H2,1-5H3;7-10,18H,2-6H2,1H3;7H,1-4H3 |
| InChIKey | GAXVYXCVCONJMN-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 121.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 847.51 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|