About 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane
1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane (PubChem CID 158204836) has the molecular formula C20H38OS
and a molecular weight of 326.59 g/mol. Its IUPAC name is 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane.
Molecular Properties
| Compound Name | 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane |
| PubChem CID | 158204836 |
| Molecular Formula | C20H38OS |
| Molecular Weight | 326.59 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane |
| SMILES | C.C=C(CCCCCCCCCCCC)C(=C)C(O)=S(=C)=C |
| InChI | InChI=1S/C19H34OS.CH4/c1-6-7-8-9-10-11-12-13-14-15-16-17(2)18(3)19(20)21(4)5;/h20H,2-16H2,1H3;1H4 |
| InChIKey | GBJGSQXUCIDJHV-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.59 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane?
The IUPAC name of 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane (CID 158204836) is 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane.
What is the SMILES notation for 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane?
The canonical SMILES for 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane is C.C=C(CCCCCCCCCCCC)C(=C)C(O)=S(=C)=C.
What is the InChIKey of 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane?
The InChIKey is GBJGSQXUCIDJHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H34OS.CH4/c1-6-7-8-9-10-11-12-13-14-15-16-17(2)18(3)19(20)21(4)5;/h20H,2-16H2,1H3;1H4.
What are the key properties of 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane?
1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane has a molecular weight of 326.59 g/mol, XLogP of 6.87, 13 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(dimethylidene-λ6-sulfanylidene)-2,3-dimethylidenepentadecan-1-ol;methane is sourced from PubChem (CID 158204836), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).