C28H38O2 — CID 19752128
2,3,4,5,6,7,8,9,10,11-decamethylideneoctadecane-1,1-diol (PubChem CID 19752128) has the molecular formula C28H38O2 and a molecular weight of 406.61 g/mol. Its IUPAC name is 2,3,4,5,6,7,8,9,10,11-decamethylideneoctadecane-1,1-diol.
| Compound Name | 2,3,4,5,6,7,8,9,10,11-decamethylideneoctadecane-1,1-diol |
|---|---|
| PubChem CID | 19752128 |
| Molecular Formula | C28H38O2 |
| Molecular Weight | 406.61 g/mol |
| Exact Mass | 406.29 |
| IUPAC Name | 2,3,4,5,6,7,8,9,10,11-decamethylideneoctadecane-1,1-diol |
| SMILES | C=C(CCCCCCC)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(=C)C(O)O |
| InChI | InChI=1S/C28H38O2/c1-12-13-14-15-16-17-18(2)19(3)20(4)21(5)22(6)23(7)24(8)25(9)26(10)27(11)28(29)30/h28-30H,2-17H2,1H3 |
| InChIKey | RVPKLGMGNHUDDR-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.61 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|