C20H32OS — CID 23084349
3,4,5-trimethylidene-2-prop-1-en-2-yltetradecanethioic S-acid (PubChem CID 23084349) has the molecular formula C20H32OS and a molecular weight of 320.54 g/mol. Its IUPAC name is 3,4,5-trimethylidene-2-prop-1-en-2-yltetradecanethioic S-acid.
| Compound Name | 3,4,5-trimethylidene-2-prop-1-en-2-yltetradecanethioic S-acid |
|---|---|
| PubChem CID | 23084349 |
| Molecular Formula | C20H32OS |
| Molecular Weight | 320.54 g/mol |
| Exact Mass | 320.22 |
| IUPAC Name | 3,4,5-trimethylidene-2-prop-1-en-2-yltetradecanethioic S-acid |
| SMILES | C=C(CCCCCCCCC)C(=C)C(=C)C(C(=C)C)C(=O)S |
| InChI | InChI=1S/C20H32OS/c1-7-8-9-10-11-12-13-14-16(4)17(5)18(6)19(15(2)3)20(21)22/h19H,2,4-14H2,1,3H3,(H,21,22) |
| InChIKey | QEQRZDUDAWLPIM-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.54 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|