C18H26O4 — CID 158205687
2-[6-(3,6-dioxoheptyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid (PubChem CID 158205687) has the molecular formula C18H26O4 and a molecular weight of 306.40 g/mol. Its IUPAC name is 2-[6-(3,6-dioxoheptyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid.
| Compound Name | 2-[6-(3,6-dioxoheptyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
|---|---|
| PubChem CID | 158205687 |
| Molecular Formula | C18H26O4 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | 2-[6-(3,6-dioxoheptyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetic acid |
| SMILES | CCC1=CC2C(C1)CC2(CCC(=O)CCC(C)=O)CC(=O)O |
| InChI | InChI=1S/C18H26O4/c1-3-13-8-14-10-18(11-17(21)22,16(14)9-13)7-6-15(20)5-4-12(2)19/h9,14,16H,3-8,10-11H2,1-2H3,(H,21,22) |
| InChIKey | GBLVRIVDIFVQJB-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|