C21H35NO4 — CID 140682445
ditert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate (PubChem CID 140682445) has the molecular formula C21H35NO4 and a molecular weight of 365.51 g/mol. Its IUPAC name is ditert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate.
| Compound Name | ditert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate |
|---|---|
| PubChem CID | 140682445 |
| Molecular Formula | C21H35NO4 |
| Molecular Weight | 365.51 g/mol |
| Exact Mass | 365.26 |
| IUPAC Name | ditert-butyl 2-[6-(aminomethyl)-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]propanedioate |
| SMILES | CCC1=CC2C(C1)CC2(CN)C(C(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H35NO4/c1-8-13-9-14-11-21(12-22,15(14)10-13)16(17(23)25-19(2,3)4)18(24)26-20(5,6)7/h10,14-16H,8-9,11-12,22H2,1-7H3 |
| InChIKey | OEBFULHANRAHTE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.51 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|