C9H14O4S — CID 71582808
(1R,5S,6R)-3-ethyl-6-hydroxybicyclo[3.2.0]hept-3-ene-6-sulfonic acid (PubChem CID 71582808) has the molecular formula C9H14O4S and a molecular weight of 218.27 g/mol. Its IUPAC name is (1R,5S,6R)-3-ethyl-6-hydroxybicyclo[3.2.0]hept-3-ene-6-sulfonic acid.
| Compound Name | (1R,5S,6R)-3-ethyl-6-hydroxybicyclo[3.2.0]hept-3-ene-6-sulfonic acid |
|---|---|
| PubChem CID | 71582808 |
| Molecular Formula | C9H14O4S |
| Molecular Weight | 218.27 g/mol |
| Exact Mass | 218.06 |
| IUPAC Name | (1R,5S,6R)-3-ethyl-6-hydroxybicyclo[3.2.0]hept-3-ene-6-sulfonic acid |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@@]2(O)S(=O)(=O)O |
| InChI | InChI=1S/C9H14O4S/c1-2-6-3-7-5-9(10,8(7)4-6)14(11,12)13/h4,7-8,10H,2-3,5H2,1H3,(H,11,12,13)/t7-,8-,9-/m1/s1 |
| InChIKey | FSXOTWXVXFDJNK-IWSPIJDZSA-N |
| XLogP | 0.94 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.27 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|