C12H17NO — CID 175675558
(1S,5R)-3-ethylspiro[bicyclo[3.2.0]hept-2-ene-7,4'-pyrrolidine]-2'-one (PubChem CID 175675558) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is (1S,5R)-3-ethylspiro[bicyclo[3.2.0]hept-2-ene-7,4'-pyrrolidine]-2'-one.
| Compound Name | (1S,5R)-3-ethylspiro[bicyclo[3.2.0]hept-2-ene-7,4'-pyrrolidine]-2'-one |
|---|---|
| PubChem CID | 175675558 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | (1S,5R)-3-ethylspiro[bicyclo[3.2.0]hept-2-ene-7,4'-pyrrolidine]-2'-one |
| SMILES | CCC1=C[C@@H]2[C@H](C1)CC21CNC(=O)C1 |
| InChI | InChI=1S/C12H17NO/c1-2-8-3-9-5-12(10(9)4-8)6-11(14)13-7-12/h4,9-10H,2-3,5-7H2,1H3,(H,13,14)/t9-,10-,12?/m1/s1 |
| InChIKey | FMUVDFCMIVLIBM-UVTZGIPTSA-N |
| XLogP | 1.87 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|