C12H14NO2- — CID 132519022
2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate (PubChem CID 132519022) has the molecular formula C12H14NO2- and a molecular weight of 204.25 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate.
| Compound Name | 2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
|---|---|
| PubChem CID | 132519022 |
| Molecular Formula | C12H14NO2- |
| Molecular Weight | 204.25 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@]2(C#N)CC(=O)[O-] |
| InChI | InChI=1S/C12H15NO2/c1-2-8-3-9-5-12(7-13,6-11(14)15)10(9)4-8/h4,9-10H,2-3,5-6H2,1H3,(H,14,15)/p-1/t9-,10-,12-/m1/s1 |
| InChIKey | NGFGCCPBCQKRRN-CKYFFXLPSA-M |
| XLogP | 1.01 |
| TPSA | 63.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.25 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|