C17H22N2O4 — CID 163434091
diethyl 2-[(1R,5S,6R)-6-cyano-3-(2-iminoethyl)-6-bicyclo[3.2.0]hept-3-enyl]propanedioate (PubChem CID 163434091) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is diethyl 2-[(1R,5S,6R)-6-cyano-3-(2-iminoethyl)-6-bicyclo[3.2.0]hept-3-enyl]propanedioate.
| Compound Name | diethyl 2-[(1R,5S,6R)-6-cyano-3-(2-iminoethyl)-6-bicyclo[3.2.0]hept-3-enyl]propanedioate |
|---|---|
| PubChem CID | 163434091 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | diethyl 2-[(1R,5S,6R)-6-cyano-3-(2-iminoethyl)-6-bicyclo[3.2.0]hept-3-enyl]propanedioate |
| SMILES | [H]/N=C/CC1=C[C@@H]2[C@H](C1)C[C@]2(C#N)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C17H22N2O4/c1-3-22-15(20)14(16(21)23-4-2)17(10-19)9-12-7-11(5-6-18)8-13(12)17/h6,8,12-14,18H,3-5,7,9H2,1-2H3/b18-6+/t12-,13-,17-/m1/s1 |
| InChIKey | ASYXNVBDSRDZCD-XVVUUXGJSA-N |
| XLogP | 2.24 |
| TPSA | 100.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|