C18H28N2O2 — CID 131743301
2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;cyclohexylazanium (PubChem CID 131743301) has the molecular formula C18H28N2O2 and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;cyclohexylazanium.
| Compound Name | 2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;cyclohexylazanium |
|---|---|
| PubChem CID | 131743301 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[(1R,5S,6S)-6-cyano-3-ethyl-6-bicyclo[3.2.0]hept-3-enyl]acetate;cyclohexylazanium |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@]2(C#N)CC(=O)[O-].[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C12H15NO2.C6H13N/c1-2-8-3-9-5-12(7-13,6-11(14)15)10(9)4-8;7-6-4-2-1-3-5-6/h4,9-10H,2-3,5-6H2,1H3,(H,14,15);6H,1-5,7H2/t9-,10-,12-;/m1./s1 |
| InChIKey | ZNAATZOEQUQSHX-TXULWXBWSA-N |
| XLogP | 1.57 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|