C17H22N2O2 — CID 158725308
(1R,5S,6S)-N-benzyl-3-ethyl-6-(nitromethyl)bicyclo[3.2.0]hept-3-en-6-amine (PubChem CID 158725308) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is (1R,5S,6S)-N-benzyl-3-ethyl-6-(nitromethyl)bicyclo[3.2.0]hept-3-en-6-amine.
| Compound Name | (1R,5S,6S)-N-benzyl-3-ethyl-6-(nitromethyl)bicyclo[3.2.0]hept-3-en-6-amine |
|---|---|
| PubChem CID | 158725308 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | (1R,5S,6S)-N-benzyl-3-ethyl-6-(nitromethyl)bicyclo[3.2.0]hept-3-en-6-amine |
| SMILES | CCC1=C[C@@H]2[C@H](C1)C[C@]2(C[N+](=O)[O-])NCc1ccccc1 |
| InChI | InChI=1S/C17H22N2O2/c1-2-13-8-15-10-17(12-19(20)21,16(15)9-13)18-11-14-6-4-3-5-7-14/h3-7,9,15-16,18H,2,8,10-12H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | IKKRRRKXZZVNRQ-BRWVUGGUSA-N |
| XLogP | 3.17 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|