C31H43O8P — CID 158209760
carbon dioxide;[(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,10,14,17,17-pentamethyl-2-phenyl-9-phosphanyloxy-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] acetate (PubChem CID 158209760) has the molecular formula C31H43O8P and a molecular weight of 574.65 g/mol. Its IUPAC name is carbon dioxide;[(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,10,14,17,17-pentamethyl-2-phenyl-9-phosphanyloxy-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] acetate.
| Compound Name | carbon dioxide;[(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,10,14,17,17-pentamethyl-2-phenyl-9-phosphanyloxy-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] acetate |
|---|---|
| PubChem CID | 158209760 |
| Molecular Formula | C31H43O8P |
| Molecular Weight | 574.65 g/mol |
| Exact Mass | 574.27 |
| IUPAC Name | carbon dioxide;[(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,10,14,17,17-pentamethyl-2-phenyl-9-phosphanyloxy-12-tetracyclo[11.3.1.03,10.04,7]heptadec-13-enyl] acetate |
| SMILES | CC(=O)O[C@@H]1C2=C(C)[C@@H](O)C[C@@](O)(C(c3ccccc3)C3[C@@](C)([C@@H](OP)C[C@H]4CC[C@@]34C)[C@H]1O)C2(C)C.O=C=O |
| InChI | InChI=1S/C30H43O6P.CO2/c1-16-20(32)15-30(34)23(18-10-8-7-9-11-18)25-28(5)13-12-19(28)14-21(36-37)29(25,6)26(33)24(35-17(2)31)22(16)27(30,3)4;2-1-3/h7-11,19-21,23-26,32-34H,12-15,37H2,1-6H3;/t19-,20+,21+,23?,24-,25?,26+,28-,29-,30-;/m1./s1 |
| InChIKey | GBXWACPEAVZCLG-JECKBSRYSA-N |
| XLogP | 3.95 |
| TPSA | 130.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.65 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|