C30H42O6 — CID 58308512
[(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,9,10,14,17,17-hexamethyl-2-phenyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate (PubChem CID 58308512) has the molecular formula C30H42O6 and a molecular weight of 498.66 g/mol. Its IUPAC name is [(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,9,10,14,17,17-hexamethyl-2-phenyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate.
| Compound Name | [(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,9,10,14,17,17-hexamethyl-2-phenyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate |
|---|---|
| PubChem CID | 58308512 |
| Molecular Formula | C30H42O6 |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(1R,2R,4R,7R,9S,10R,11R,12R,15S)-1,11,15-trihydroxy-4,9,10,14,17,17-hexamethyl-2-phenyl-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-12-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C2=C(C)[C@@H](O)C[C@@](O)(C(c3ccccc3)C3[C@@](C)([C@@H](C)C[C@H]4OC[C@@]34C)[C@H]1O)C2(C)C |
| InChI | InChI=1S/C30H42O6/c1-16-13-21-28(6,15-35-21)25-23(19-11-9-8-10-12-19)30(34)14-20(32)17(2)22(27(30,4)5)24(36-18(3)31)26(33)29(16,25)7/h8-12,16,20-21,23-26,32-34H,13-15H2,1-7H3/t16-,20-,21+,23?,24+,25?,26-,28+,29+,30+/m0/s1 |
| InChIKey | JOFXBZXDHBPFLU-NDDYUQPISA-N |
| XLogP | 3.98 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|