C26H38O11 — CID 162989855
(4,7-diacetyloxy-2,8,10,13-tetrahydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadec-5-en-12-yl) acetate (PubChem CID 162989855) has the molecular formula C26H38O11 and a molecular weight of 526.58 g/mol. Its IUPAC name is (4,7-diacetyloxy-2,8,10,13-tetrahydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadec-5-en-12-yl) acetate.
| Compound Name | (4,7-diacetyloxy-2,8,10,13-tetrahydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadec-5-en-12-yl) acetate |
|---|---|
| PubChem CID | 162989855 |
| Molecular Formula | C26H38O11 |
| Molecular Weight | 526.58 g/mol |
| Exact Mass | 526.24 |
| IUPAC Name | (4,7-diacetyloxy-2,8,10,13-tetrahydroxy-5,9,17,17-tetramethyl-15-oxatetracyclo[7.6.1.12,6.013,16]heptadec-5-en-12-yl) acetate |
| SMILES | CC(=O)OC1CC2(O)C3OCC4(O)C(OC(C)=O)CC(O)C(C)(C(O)C(OC(C)=O)C(=C1C)C2(C)C)C34 |
| InChI | InChI=1S/C26H38O11/c1-11-15(35-12(2)27)9-26(33)22-20-24(7,21(31)19(37-14(4)29)18(11)23(26,5)6)16(30)8-17(36-13(3)28)25(20,32)10-34-22/h15-17,19-22,30-33H,8-10H2,1-7H3 |
| InChIKey | PQMYVTAUNFSNGE-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 169.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.58 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|