C29H40O13 — CID 162930184
(2',9',10',13'-tetraacetyloxy-1',7'-dihydroxy-12',15',15'-trimethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-5'-yl) acetate (PubChem CID 162930184) has the molecular formula C29H40O13 and a molecular weight of 596.63 g/mol. Its IUPAC name is (2',9',10',13'-tetraacetyloxy-1',7'-dihydroxy-12',15',15'-trimethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-5'-yl) acetate.
| Compound Name | (2',9',10',13'-tetraacetyloxy-1',7'-dihydroxy-12',15',15'-trimethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-5'-yl) acetate |
|---|---|
| PubChem CID | 162930184 |
| Molecular Formula | C29H40O13 |
| Molecular Weight | 596.63 g/mol |
| Exact Mass | 596.25 |
| IUPAC Name | (2',9',10',13'-tetraacetyloxy-1',7'-dihydroxy-12',15',15'-trimethylspiro[oxirane-2,4'-tricyclo[9.3.1.03,8]pentadec-11-ene]-5'-yl) acetate |
| SMILES | CC(=O)OC1CC2(O)C(OC(C)=O)C3C(C(O)CC(OC(C)=O)C34CO4)C(OC(C)=O)C(OC(C)=O)C(=C1C)C2(C)C |
| InChI | InChI=1S/C29H40O13/c1-12-19(38-13(2)30)10-29(36)26(42-17(6)34)23-21(18(35)9-20(39-14(3)31)28(23)11-37-28)24(40-15(4)32)25(41-16(5)33)22(12)27(29,7)8/h18-21,23-26,35-36H,9-11H2,1-8H3 |
| InChIKey | FFCWRLFQIKDRNO-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 184.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.63 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|