C20H24O3S2 — CID 158211532
2-[(4-methylphenyl)methylsulfonyl]-1-(1-thiophen-3-ylcyclohexyl)ethanone (PubChem CID 158211532) has the molecular formula C20H24O3S2 and a molecular weight of 376.54 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylsulfonyl]-1-(1-thiophen-3-ylcyclohexyl)ethanone.
| Compound Name | 2-[(4-methylphenyl)methylsulfonyl]-1-(1-thiophen-3-ylcyclohexyl)ethanone |
|---|---|
| PubChem CID | 158211532 |
| Molecular Formula | C20H24O3S2 |
| Molecular Weight | 376.54 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | 2-[(4-methylphenyl)methylsulfonyl]-1-(1-thiophen-3-ylcyclohexyl)ethanone |
| SMILES | Cc1ccc(CS(=O)(=O)CC(=O)C2(c3ccsc3)CCCCC2)cc1 |
| InChI | InChI=1S/C20H24O3S2/c1-16-5-7-17(8-6-16)14-25(22,23)15-19(21)20(10-3-2-4-11-20)18-9-12-24-13-18/h5-9,12-13H,2-4,10-11,14-15H2,1H3 |
| InChIKey | ZLFOFULXBQGRTI-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.54 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |