C10H13NO2S2 — CID 82182371
2-[(4-methylphenyl)methylsulfonyl]ethanethioamide (PubChem CID 82182371) has the molecular formula C10H13NO2S2 and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-[(4-methylphenyl)methylsulfonyl]ethanethioamide.
| Compound Name | 2-[(4-methylphenyl)methylsulfonyl]ethanethioamide |
|---|---|
| PubChem CID | 82182371 |
| Molecular Formula | C10H13NO2S2 |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.04 |
| IUPAC Name | 2-[(4-methylphenyl)methylsulfonyl]ethanethioamide |
| SMILES | Cc1ccc(CS(=O)(=O)CC(N)=S)cc1 |
| InChI | InChI=1S/C10H13NO2S2/c1-8-2-4-9(5-3-8)6-15(12,13)7-10(11)14/h2-5H,6-7H2,1H3,(H2,11,14) |
| InChIKey | MVOGQSKZESCEAS-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|