C36H23Br7N6O2 — CID 158213649
3,5-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,7-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,5,7-tribromo-6-methyl-9H-pyrido[2,3-b]indole (PubChem CID 158213649) has the molecular formula C36H23Br7N6O2 and a molecular weight of 1130.95 g/mol. Its IUPAC name is 3,5-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,7-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,5,7-tribromo-6-methyl-9H-pyrido[2,3-b]indole.
| Compound Name | 3,5-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,7-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,5,7-tribromo-6-methyl-9H-pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 158213649 |
| Molecular Formula | C36H23Br7N6O2 |
| Molecular Weight | 1130.95 g/mol |
| Exact Mass | 1123.62 |
| IUPAC Name | 3,5-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,7-dibromo-6-methoxy-9H-pyrido[2,3-b]indole;3,5,7-tribromo-6-methyl-9H-pyrido[2,3-b]indole |
| SMILES | COc1cc2c(cc1Br)[nH]c1ncc(Br)cc12.COc1ccc2[nH]c3ncc(Br)cc3c2c1Br.Cc1c(Br)cc2[nH]c3ncc(Br)cc3c2c1Br |
| InChI | InChI=1S/C12H7Br3N2.2C12H8Br2N2O/c1-5-8(14)3-9-10(11(5)15)7-2-6(13)4-16-12(7)17-9;1-17-11-3-7-8-2-6(13)5-15-12(8)16-10(7)4-9(11)14;1-17-9-3-2-8-10(11(9)14)7-4-6(13)5-15-12(7)16-8/h2-4H,1H3,(H,16,17);2*2-5H,1H3,(H,15,16) |
| InChIKey | GCJLYJJHZGXPEY-UHFFFAOYSA-N |
| XLogP | 13.81 |
| TPSA | 104.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1130.95 |
| LogP ≤ 5 | 13.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |