C52H64F2N2O2 — CID 158214628
[4-fluoro-1-[4-(5-heptyl-2-pyridinyl)phenyl]pentan-2-yl] 4-butyl-2-fluoro-3-[4-(5-heptyl-2-pyridinyl)phenyl]benzoate (PubChem CID 158214628) has the molecular formula C52H64F2N2O2 and a molecular weight of 787.09 g/mol. Its IUPAC name is [4-fluoro-1-[4-(5-heptyl-2-pyridinyl)phenyl]pentan-2-yl] 4-butyl-2-fluoro-3-[4-(5-heptyl-2-pyridinyl)phenyl]benzoate.
| Compound Name | [4-fluoro-1-[4-(5-heptyl-2-pyridinyl)phenyl]pentan-2-yl] 4-butyl-2-fluoro-3-[4-(5-heptyl-2-pyridinyl)phenyl]benzoate |
|---|---|
| PubChem CID | 158214628 |
| Molecular Formula | C52H64F2N2O2 |
| Molecular Weight | 787.09 g/mol |
| Exact Mass | 786.49 |
| IUPAC Name | [4-fluoro-1-[4-(5-heptyl-2-pyridinyl)phenyl]pentan-2-yl] 4-butyl-2-fluoro-3-[4-(5-heptyl-2-pyridinyl)phenyl]benzoate |
| SMILES | CCCCCCCc1ccc(-c2ccc(CC(CC(C)F)OC(=O)c3ccc(CCCC)c(-c4ccc(-c5ccc(CCCCCCC)cn5)cc4)c3F)cc2)nc1 |
| InChI | InChI=1S/C52H64F2N2O2/c1-5-8-11-13-15-17-40-22-32-48(55-36-40)42-24-20-39(21-25-42)35-46(34-38(4)53)58-52(57)47-31-30-44(19-10-7-3)50(51(47)54)45-28-26-43(27-29-45)49-33-23-41(37-56-49)18-16-14-12-9-6-2/h20-33,36-38,46H,5-19,34-35H2,1-4H3 |
| InChIKey | GCMMRPFKADUWPZ-UHFFFAOYSA-N |
| XLogP | 14.50 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 787.09 |
| LogP ≤ 5 | 14.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|