C14H6BrF6I4NO2 — CID 158214774
2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline (PubChem CID 158214774) has the molecular formula C14H6BrF6I4NO2 and a molecular weight of 921.71 g/mol. Its IUPAC name is 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline.
| Compound Name | 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 158214774 |
| Molecular Formula | C14H6BrF6I4NO2 |
| Molecular Weight | 921.71 g/mol |
| Exact Mass | 920.57 |
| IUPAC Name | 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1cc(I)c(Br)c(I)c1.Nc1c(I)cc(OC(F)(F)F)cc1I |
| InChI | InChI=1S/C7H2BrF3I2O.C7H4F3I2NO/c8-6-4(12)1-3(2-5(6)13)14-7(9,10)11;8-7(9,10)14-3-1-4(11)6(13)5(12)2-3/h1-2H;1-2H,13H2 |
| InChIKey | GCMYXUTWQBWVTF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 921.71 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|