About 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline
2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline (PubChem CID 158214774) has the molecular formula C14H6BrF6I4NO2
and a molecular weight of 921.71 g/mol. Its IUPAC name is 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline.
Molecular Properties
| Compound Name | 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline |
| PubChem CID | 158214774 |
| Molecular Formula | C14H6BrF6I4NO2 |
| Molecular Weight | 921.71 g/mol |
| Exact Mass | 920.57 |
| IUPAC Name | 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline |
| SMILES | FC(F)(F)Oc1cc(I)c(Br)c(I)c1.Nc1c(I)cc(OC(F)(F)F)cc1I |
| InChI | InChI=1S/C7H2BrF3I2O.C7H4F3I2NO/c8-6-4(12)1-3(2-5(6)13)14-7(9,10)11;8-7(9,10)14-3-1-4(11)6(13)5(12)2-3/h1-2H;1-2H,13H2 |
| InChIKey | GCMYXUTWQBWVTF-UHFFFAOYSA-N |
| XLogP | 7.93 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 921.71 |
| LogP ≤ 5 | 7.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline?
The IUPAC name of 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline (CID 158214774) is 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline.
What is the SMILES notation for 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline?
The canonical SMILES for 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline is FC(F)(F)Oc1cc(I)c(Br)c(I)c1.Nc1c(I)cc(OC(F)(F)F)cc1I.
What is the InChIKey of 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline?
The InChIKey is GCMYXUTWQBWVTF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H2BrF3I2O.C7H4F3I2NO/c8-6-4(12)1-3(2-5(6)13)14-7(9,10)11;8-7(9,10)14-3-1-4(11)6(13)5(12)2-3/h1-2H;1-2H,13H2.
What are the key properties of 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline?
2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline has a molecular weight of 921.71 g/mol, XLogP of 7.93, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1,3-diiodo-5-(trifluoromethoxy)benzene;2,6-diiodo-4-(trifluoromethoxy)aniline is sourced from PubChem (CID 158214774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).