C68H116O12Si3 — CID 158218010
tetrakis(but-3-enyl) silicate;tetrakis(4-prop-2-enylhept-6-enyl) silicate;tetrakis(prop-2-enyl) silicate (PubChem CID 158218010) has the molecular formula C68H116O12Si3 and a molecular weight of 1209.92 g/mol. Its IUPAC name is tetrakis(but-3-enyl) silicate;tetrakis(4-prop-2-enylhept-6-enyl) silicate;tetrakis(prop-2-enyl) silicate.
| Compound Name | tetrakis(but-3-enyl) silicate;tetrakis(4-prop-2-enylhept-6-enyl) silicate;tetrakis(prop-2-enyl) silicate |
|---|---|
| PubChem CID | 158218010 |
| Molecular Formula | C68H116O12Si3 |
| Molecular Weight | 1209.92 g/mol |
| Exact Mass | 1208.78 |
| IUPAC Name | tetrakis(but-3-enyl) silicate;tetrakis(4-prop-2-enylhept-6-enyl) silicate;tetrakis(prop-2-enyl) silicate |
| SMILES | C=CCC(CC=C)CCCO[Si](OCCCC(CC=C)CC=C)(OCCCC(CC=C)CC=C)OCCCC(CC=C)CC=C.C=CCCO[Si](OCCC=C)(OCCC=C)OCCC=C.C=CCO[Si](OCC=C)(OCC=C)OCC=C |
| InChI | InChI=1S/C40H68O4Si.C16H28O4Si.C12H20O4Si/c1-9-21-37(22-10-2)29-17-33-41-45(42-34-18-30-38(23-11-3)24-12-4,43-35-19-31-39(25-13-5)26-14-6)44-36-20-32-40(27-15-7)28-16-8;1-5-9-13-17-21(18-14-10-6-2,19-15-11-7-3)20-16-12-8-4;1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4/h9-16,37-40H,1-8,17-36H2;5-8H,1-4,9-16H2;5-8H,1-4,9-12H2 |
| InChIKey | GCWZRMLGANLSME-UHFFFAOYSA-N |
| XLogP | 17.71 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 64 |
| Heavy Atoms | 83 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1209.92 |
| LogP ≤ 5 | 17.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|