C18H31N — CID 158221381
ethane;2-(2-methylhexyl)-3,4-dihydro-1H-isoquinoline (PubChem CID 158221381) has the molecular formula C18H31N and a molecular weight of 261.45 g/mol. Its IUPAC name is ethane;2-(2-methylhexyl)-3,4-dihydro-1H-isoquinoline.
| Compound Name | ethane;2-(2-methylhexyl)-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 158221381 |
| Molecular Formula | C18H31N |
| Molecular Weight | 261.45 g/mol |
| Exact Mass | 261.25 |
| IUPAC Name | ethane;2-(2-methylhexyl)-3,4-dihydro-1H-isoquinoline |
| SMILES | CC.CCCCC(C)CN1CCc2ccccc2C1 |
| InChI | InChI=1S/C16H25N.C2H6/c1-3-4-7-14(2)12-17-11-10-15-8-5-6-9-16(15)13-17;1-2/h5-6,8-9,14H,3-4,7,10-13H2,1-2H3;1-2H3 |
| InChIKey | GDHAVVMNMUYMEH-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.45 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |