C20H33NO5S — CID 86590894
[1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-ethylhexoxy)propan-2-yl] hydrogen sulfate (PubChem CID 86590894) has the molecular formula C20H33NO5S and a molecular weight of 399.55 g/mol. Its IUPAC name is [1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-ethylhexoxy)propan-2-yl] hydrogen sulfate.
| Compound Name | [1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-ethylhexoxy)propan-2-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 86590894 |
| Molecular Formula | C20H33NO5S |
| Molecular Weight | 399.55 g/mol |
| Exact Mass | 399.21 |
| IUPAC Name | [1-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-ethylhexoxy)propan-2-yl] hydrogen sulfate |
| SMILES | CCCCC(CC)COCC(CN1CCc2ccccc2C1)OS(=O)(=O)O |
| InChI | InChI=1S/C20H33NO5S/c1-3-5-8-17(4-2)15-25-16-20(26-27(22,23)24)14-21-12-11-18-9-6-7-10-19(18)13-21/h6-7,9-10,17,20H,3-5,8,11-16H2,1-2H3,(H,22,23,24) |
| InChIKey | RGSNRPLIQQXINL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.55 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|