C52H88N2O6S — CID 87405487
bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-pentylnonoxy)propyl] sulfate (PubChem CID 87405487) has the molecular formula C52H88N2O6S and a molecular weight of 869.35 g/mol. Its IUPAC name is bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-pentylnonoxy)propyl] sulfate.
| Compound Name | bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-pentylnonoxy)propyl] sulfate |
|---|---|
| PubChem CID | 87405487 |
| Molecular Formula | C52H88N2O6S |
| Molecular Weight | 869.35 g/mol |
| Exact Mass | 868.64 |
| IUPAC Name | bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-(2-pentylnonoxy)propyl] sulfate |
| SMILES | CCCCCCCC(CCCCC)COCC(COS(=O)(=O)OCC(COCC(CCCCC)CCCCCCC)N1CCc2ccccc2C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C52H88N2O6S/c1-5-9-13-15-19-27-45(25-17-11-7-3)39-57-41-51(53-35-33-47-29-21-23-31-49(47)37-53)43-59-61(55,56)60-44-52(54-36-34-48-30-22-24-32-50(48)38-54)42-58-40-46(26-18-12-8-4)28-20-16-14-10-6-2/h21-24,29-32,45-46,51-52H,5-20,25-28,33-44H2,1-4H3 |
| InChIKey | VEMONVGELRWLDI-UHFFFAOYSA-N |
| XLogP | 12.27 |
| TPSA | 77.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 869.35 |
| LogP ≤ 5 | 12.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|