C44H72N2O10S — CID 87961760
bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(2-hexoxyethoxy)ethoxy]propyl] sulfate (PubChem CID 87961760) has the molecular formula C44H72N2O10S and a molecular weight of 821.13 g/mol. Its IUPAC name is bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(2-hexoxyethoxy)ethoxy]propyl] sulfate.
| Compound Name | bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(2-hexoxyethoxy)ethoxy]propyl] sulfate |
|---|---|
| PubChem CID | 87961760 |
| Molecular Formula | C44H72N2O10S |
| Molecular Weight | 821.13 g/mol |
| Exact Mass | 820.49 |
| IUPAC Name | bis[2-(3,4-dihydro-1H-isoquinolin-2-yl)-3-[2-(2-hexoxyethoxy)ethoxy]propyl] sulfate |
| SMILES | CCCCCCOCCOCCOCC(COS(=O)(=O)OCC(COCCOCCOCCCCCC)N1CCc2ccccc2C1)N1CCc2ccccc2C1 |
| InChI | InChI=1S/C44H72N2O10S/c1-3-5-7-13-23-49-25-27-51-29-31-53-35-43(45-21-19-39-15-9-11-17-41(39)33-45)37-55-57(47,48)56-38-44(46-22-20-40-16-10-12-18-42(40)34-46)36-54-32-30-52-28-26-50-24-14-8-6-4-2/h9-12,15-18,43-44H,3-8,13-14,19-38H2,1-2H3 |
| InChIKey | UIPSPJADBRSTBV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 114.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.13 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|